Compound Q&A

What industries use 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

Answer

2,2'-Dibromo-4,4'-diiodobiphenyl
2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is used in the pharmaceutical industry for the synthesis of certain dyes and photovoltaic materials. It also finds applications in the semiconductor industry for doping materials and in the polymer industry as a precursor for functional polymers. Additionally, it is utilized in the development of sensors due to its unique photochemical properties.

About

English Name 2,2'-Dibromo-4,4'-diiodobiphenyl
Molecular Formula C12H6Br2I2
Molecular Weight 563.8 g/mol
SMILES c1cc(c(cc1I)Br)c2ccc(cc2Br)I
InChIKey MJZNAWMPPSJRJX-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) typically synthesized?

2,2'-Dibromo-4,4'-diiodobiphenyl is typically synthesized through the bromination and subsequent iod...

Compound Q&A

What precautions should be taken when handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

When handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...