Compound Q&A

What are the physical and chemical properties of 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

Answer

2,2'-Dibromo-4,4'-diiodobiphenyl
2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is a crystalline solid with a molecular weight of approximately 664.07 g/mol. It is poorly soluble in water but soluble in common organic solvents like dichloromethane and acetone. Chemically, it is highly reactive due to the presence of bromine and iodine functionalities, making it susceptible to various substitution reactions.

About

English Name 2,2'-Dibromo-4,4'-diiodobiphenyl
Molecular Formula C12H6Br2I2
Molecular Weight 563.8 g/mol
SMILES c1cc(c(cc1I)Br)c2ccc(cc2Br)I
InChIKey MJZNAWMPPSJRJX-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) typically synthesized?

2,2'-Dibromo-4,4'-diiodobiphenyl is typically synthesized through the bromination and subsequent iod...

Compound Q&A

What industries use 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

When handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...