Compound Q&A

How is 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) typically synthesized?

Answer

2,2'-Dibromo-4,4'-diiodobiphenyl
2,2'-Dibromo-4,4'-diiodobiphenyl is typically synthesized through the bromination and subsequent iodination of biphenyl using appropriate reagents. The reaction is usually carried out in the presence of a Lewis acid catalyst like aluminum bromide or iron(III) chloride to facilitate the electrophilic aromatic substitution reactions. The yield is generally moderate to high, depending on the reaction conditions.

About

English Name 2,2'-Dibromo-4,4'-diiodobiphenyl
Molecular Formula C12H6Br2I2
Molecular Weight 563.8 g/mol
SMILES c1cc(c(cc1I)Br)c2ccc(cc2Br)I
InChIKey MJZNAWMPPSJRJX-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3) is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3)?

When handling 2,2'-Dibromo-4,4'-diiodobiphenyl (CAS: 852138-93-3), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...