Compound Q&A

What industries use 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

Answer

6-Chloro-2,3-pyridinedicarboxylic acid
6-Chloro-2,3-pyridinedicarboxylic acid is used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It also finds applications in the polymer industry for the synthesis of functionalized polymers and in the semiconductor industry for the production of photoresists. Additionally, it can be utilized in the development of sensors and as a precursor in various organic synthesis reactions.

About

English Name 6-Chloro-2,3-pyridinedicarboxylic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=NC(=C1C(=O)O)C(=O)O)Cl
InChIKey UZSYXDLIFFSYNQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

6-Chloro-2,3-pyridinedicarboxylic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9) typically synthesized?

6-Chloro-2,3-pyridinedicarboxylic acid is typically synthesized through the chlorination of 2,3-pyri...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

When handling 6-Chloro-2,3-pyridinedicarboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...