Compound Q&A

What are the physical and chemical properties of 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

Answer

6-Chloro-2,3-pyridinedicarboxylic acid
6-Chloro-2,3-pyridinedicarboxylic acid is a crystalline solid with a molecular weight of approximately 212.01 g/mol. It has a high solubility in water and a pKa of around 2.65 and 4.45. This compound is moderately reactive, showing basicity in its acidic form and acidity in its basic form. It can undergo esterification and amide formation under appropriate conditions.

About

English Name 6-Chloro-2,3-pyridinedicarboxylic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=NC(=C1C(=O)O)C(=O)O)Cl
InChIKey UZSYXDLIFFSYNQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9) typically synthesized?

6-Chloro-2,3-pyridinedicarboxylic acid is typically synthesized through the chlorination of 2,3-pyri...

Compound Q&A

What industries use 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

6-Chloro-2,3-pyridinedicarboxylic acid is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

When handling 6-Chloro-2,3-pyridinedicarboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...