Compound Q&A

How is 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9) typically synthesized?

Answer

6-Chloro-2,3-pyridinedicarboxylic acid
6-Chloro-2,3-pyridinedicarboxylic acid is typically synthesized through the chlorination of 2,3-pyridinedicarboxylic acid with thionyl chloride. The chlorination process is conducted under anhydrous conditions to maximize the yield. The product is then purified through recrystallization from a suitable solvent to obtain the crystalline form.

About

English Name 6-Chloro-2,3-pyridinedicarboxylic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=NC(=C1C(=O)O)C(=O)O)Cl
InChIKey UZSYXDLIFFSYNQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

6-Chloro-2,3-pyridinedicarboxylic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

6-Chloro-2,3-pyridinedicarboxylic acid is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2,3-pyridinedicarboxylic acid (CAS: 127437-44-9)?

When handling 6-Chloro-2,3-pyridinedicarboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...