Compound Q&A

What precautions should be taken when handling Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Answer

Ethyldiphenylphosphine oxide
When handling Ethyldiphenylphosphine oxide (CAS 1733-57-9), it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 1733-57-9
English Name Ethyldiphenylphosphine oxide
Molecular Formula C14H15OP
Molecular Weight 230.25 g/mol
SMILES CCP(=O)(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey AKTGKEBIBGSCLD-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Ethyldiphenylphosphine oxide, CAS 1733-57-9, is a yellow crystalline solid with a molecular weight o...

Compound Q&A

How is Ethyldiphenylphosphine oxide (CAS: 1733-57-9) typically synthesized?

Ethyldiphenylphosphine oxide is typically synthesized by the reaction of phenylphosphoryl chloride w...

Compound Q&A

What industries use Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Ethyldiphenylphosphine oxide (CAS 1733-57-9) is used in various industries, particularly in the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...