Compound Q&A

What industries use Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Answer

Ethyldiphenylphosphine oxide
Ethyldiphenylphosphine oxide (CAS 1733-57-9) is used in various industries, particularly in the synthesis of pharmaceuticals, where it serves as a precursor for the production of certain drugs. It is also utilized in the polymer industry for the modification of polymer properties and in the electronics industry for semiconductor applications.

About

CAS No 1733-57-9
English Name Ethyldiphenylphosphine oxide
Molecular Formula C14H15OP
Molecular Weight 230.25 g/mol
SMILES CCP(=O)(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey AKTGKEBIBGSCLD-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Ethyldiphenylphosphine oxide, CAS 1733-57-9, is a yellow crystalline solid with a molecular weight o...

Compound Q&A

How is Ethyldiphenylphosphine oxide (CAS: 1733-57-9) typically synthesized?

Ethyldiphenylphosphine oxide is typically synthesized by the reaction of phenylphosphoryl chloride w...

Compound Q&A

What precautions should be taken when handling Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

When handling Ethyldiphenylphosphine oxide (CAS 1733-57-9), it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...