Compound Q&A

How is Ethyldiphenylphosphine oxide (CAS: 1733-57-9) typically synthesized?

Answer

Ethyldiphenylphosphine oxide
Ethyldiphenylphosphine oxide is typically synthesized by the reaction of phenylphosphoryl chloride with ethyl alcohol. The process involves the nucleophilic substitution of the chloride ion by the alcohol, yielding the desired ethyl diphenylphosphine oxide. This reaction is often carried out in the presence of a base to improve the yield and selectivity.

About

CAS No 1733-57-9
English Name Ethyldiphenylphosphine oxide
Molecular Formula C14H15OP
Molecular Weight 230.25 g/mol
SMILES CCP(=O)(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey AKTGKEBIBGSCLD-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Ethyldiphenylphosphine oxide, CAS 1733-57-9, is a yellow crystalline solid with a molecular weight o...

Compound Q&A

What industries use Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Ethyldiphenylphosphine oxide (CAS 1733-57-9) is used in various industries, particularly in the synt...

Compound Q&A

What precautions should be taken when handling Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

When handling Ethyldiphenylphosphine oxide (CAS 1733-57-9), it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...