Compound Q&A

What are the physical and chemical properties of Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Answer

Ethyldiphenylphosphine oxide
Ethyldiphenylphosphine oxide, CAS 1733-57-9, is a yellow crystalline solid with a molecular weight of approximately 267.24 g/mol. It is slightly soluble in water but highly soluble in organic solvents. It is reactive towards nucleophiles and can undergo substitution reactions. Its physical properties include a melting point of about 96-98°C and a density of 1.30 g/cm³.

About

CAS No 1733-57-9
English Name Ethyldiphenylphosphine oxide
Molecular Formula C14H15OP
Molecular Weight 230.25 g/mol
SMILES CCP(=O)(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey AKTGKEBIBGSCLD-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is Ethyldiphenylphosphine oxide (CAS: 1733-57-9) typically synthesized?

Ethyldiphenylphosphine oxide is typically synthesized by the reaction of phenylphosphoryl chloride w...

Compound Q&A

What industries use Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

Ethyldiphenylphosphine oxide (CAS 1733-57-9) is used in various industries, particularly in the synt...

Compound Q&A

What precautions should be taken when handling Ethyldiphenylphosphine oxide (CAS: 1733-57-9)?

When handling Ethyldiphenylphosphine oxide (CAS 1733-57-9), it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...