Compound Q&A

What precautions should be taken when handling mesitylacetyl chloride (CAS: 52629-46-6)?

Answer

Mesitylacetyl chloride
When handling mesitylacetyl chloride (CAS: 52629-46-6), it is important to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from heat sources. Fume hoods should be used during handling to avoid inhalation. Spills should be cleaned up using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 52629-46-6
English Name Mesitylacetyl chloride
Molecular Formula C11H13ClO
Molecular Weight 196.68 g/mol
SMILES CC1=CC(=C(C(=C1)C)CC(=O)Cl)C
InChIKey NXCYVLQDRHQRHC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mesitylacetyl chloride (CAS: 52629-46-6)?

Mesitylacetyl chloride (CAS: 52629-46-6) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

How is mesitylacetyl chloride (CAS: 52629-46-6) typically synthesized?

Mesitylacetyl chloride (CAS: 52629-46-6) is typically synthesized by the reaction of mesitylacetic a...

Compound Q&A

What industries use mesitylacetyl chloride (CAS: 52629-46-6)?

Mesitylacetyl chloride (CAS: 52629-46-6) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...