Compound Q&A

How is mesitylacetyl chloride (CAS: 52629-46-6) typically synthesized?

Answer

Mesitylacetyl chloride
Mesitylacetyl chloride (CAS: 52629-46-6) is typically synthesized by the reaction of mesitylacetic acid with thionyl chloride. The process involves refluxing the mixture under anhydrous conditions to ensure high selectivity and yield. Catalysts such as aluminum chloride can be used to improve the reaction rate and yield.

About

CAS No 52629-46-6
English Name Mesitylacetyl chloride
Molecular Formula C11H13ClO
Molecular Weight 196.68 g/mol
SMILES CC1=CC(=C(C(=C1)C)CC(=O)Cl)C
InChIKey NXCYVLQDRHQRHC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mesitylacetyl chloride (CAS: 52629-46-6)?

Mesitylacetyl chloride (CAS: 52629-46-6) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

What industries use mesitylacetyl chloride (CAS: 52629-46-6)?

Mesitylacetyl chloride (CAS: 52629-46-6) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling mesitylacetyl chloride (CAS: 52629-46-6)?

When handling mesitylacetyl chloride (CAS: 52629-46-6), it is important to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...