Compound Q&A

What are the physical and chemical properties of Mesitylacetyl chloride (CAS: 52629-46-6)?

Answer

Mesitylacetyl chloride
Mesitylacetyl chloride (CAS: 52629-46-6) is a colorless to light yellow liquid with a molecular weight of approximately 224.24 g/mol. It has a boiling point of 128.5°C and a melting point of -19°C. This compound is soluble in organic solvents like ethanol and acetone. It is reactive, particularly in the presence of water, leading to hydrolysis and the formation of mesitylacetic acid.

About

CAS No 52629-46-6
English Name Mesitylacetyl chloride
Molecular Formula C11H13ClO
Molecular Weight 196.68 g/mol
SMILES CC1=CC(=C(C(=C1)C)CC(=O)Cl)C
InChIKey NXCYVLQDRHQRHC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is mesitylacetyl chloride (CAS: 52629-46-6) typically synthesized?

Mesitylacetyl chloride (CAS: 52629-46-6) is typically synthesized by the reaction of mesitylacetic a...

Compound Q&A

What industries use mesitylacetyl chloride (CAS: 52629-46-6)?

Mesitylacetyl chloride (CAS: 52629-46-6) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling mesitylacetyl chloride (CAS: 52629-46-6)?

When handling mesitylacetyl chloride (CAS: 52629-46-6), it is important to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...