Compound Q&A

What industries use mesitylacetyl chloride (CAS: 52629-46-6)?

Answer

Mesitylacetyl chloride
Mesitylacetyl chloride (CAS: 52629-46-6) is used in various industries, including pharmaceuticals, where it serves as an intermediate in drug synthesis. It is also used in the polymer industry for the modification of polymers, in the production of sensors, and in semiconductor manufacturing for certain purification processes.

About

CAS No 52629-46-6
English Name Mesitylacetyl chloride
Molecular Formula C11H13ClO
Molecular Weight 196.68 g/mol
SMILES CC1=CC(=C(C(=C1)C)CC(=O)Cl)C
InChIKey NXCYVLQDRHQRHC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mesitylacetyl chloride (CAS: 52629-46-6)?

Mesitylacetyl chloride (CAS: 52629-46-6) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

How is mesitylacetyl chloride (CAS: 52629-46-6) typically synthesized?

Mesitylacetyl chloride (CAS: 52629-46-6) is typically synthesized by the reaction of mesitylacetic a...

Compound Q&A

What precautions should be taken when handling mesitylacetyl chloride (CAS: 52629-46-6)?

When handling mesitylacetyl chloride (CAS: 52629-46-6), it is important to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...