Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine
When handling this compound, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and lab coat. Work should be conducted in a well-ventilated area or fume hood to avoid inhalation. Spills should be cleaned up carefully using appropriate safety measures, and the Material Safety Data Sheet (MSDS) should be consulted for detailed handling instructions.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine
Molecular Formula C26H32N2O6
Molecular Weight 468.55 g/mol
SMILES CC(C)(C)OC(=O)NCCCCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey MNAXPVXIHALBEF-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0)?

This compound is a crystalline solid with a molecular weight of approximately 610.55 g/mol. It has l...

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0) typically synthesized?

The compound is synthesized through a multi-step process involving fluorenylmethyloxycarbonyl (Fmoc)...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0)?

This compound is primarily used in pharmaceuticals, where it serves as an intermediate in the synthe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...