Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0) typically synthesized?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine
The compound is synthesized through a multi-step process involving fluorenylmethyloxycarbonyl (Fmoc) protection, followed by amidation and acylation reactions. Commonly, the Fmoc group is introduced using Fluorenylmethoxycarbonyl chloride (Fmoc-Cl), and the product is purified by column chromatography. This process requires careful control of pH and temperature to ensure high yield and selectivity.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine
Molecular Formula C26H32N2O6
Molecular Weight 468.55 g/mol
SMILES CC(C)(C)OC(=O)NCCCCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey MNAXPVXIHALBEF-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0)?

This compound is a crystalline solid with a molecular weight of approximately 610.55 g/mol. It has l...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0)?

This compound is primarily used in pharmaceuticals, where it serves as an intermediate in the synthe...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butyl]glycine (CAS: 171856-09-0)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...