Compound Q&A

What precautions should be taken when handling (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

Answer

(S)-3-(4-Bromophenyl)piperidine
When handling (S)-3-(4-Bromophenyl)piperidine, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood to minimize inhalation risks. Ensure proper storage in a cool, dry place away from direct sunlight. In case of a spill, use appropriate containment and clean up with care, referring to the safety data sheet (SDS) for specific instructions. Always follow safety guidelines and consult with a safety professional if needed.

About

English Name (S)-3-(4-Bromophenyl)piperidine
Molecular Formula C11H14BrN
Molecular Weight 240.14 g/mol
SMILES Brc1ccc(cc1)[C@@H]1CCCNC1
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

(S)-3-(4-Bromophenyl)piperidine is a white crystalline solid with a molecular weight of 262.02 g/mol...

Compound Q&A

How is (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4) typically synthesized?

(S)-3-(4-Bromophenyl)piperidine is typically synthesized via the condensation of 4-bromophenylacetic...

Compound Q&A

What industries use (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

(S)-3-(4-Bromophenyl)piperidine is primarily used in the pharmaceutical industry for the development...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...