Compound Q&A

What are the physical and chemical properties of (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

Answer

(S)-3-(4-Bromophenyl)piperidine
(S)-3-(4-Bromophenyl)piperidine is a white crystalline solid with a molecular weight of 262.02 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetonitrile. The compound reacts readily with nucleophiles and is stable under acidic and basic conditions. It is also known for its high reactivity towards electrophilic substitution at the bromophenyl group.

About

English Name (S)-3-(4-Bromophenyl)piperidine
Molecular Formula C11H14BrN
Molecular Weight 240.14 g/mol
SMILES Brc1ccc(cc1)[C@@H]1CCCNC1
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4) typically synthesized?

(S)-3-(4-Bromophenyl)piperidine is typically synthesized via the condensation of 4-bromophenylacetic...

Compound Q&A

What industries use (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

(S)-3-(4-Bromophenyl)piperidine is primarily used in the pharmaceutical industry for the development...

Compound Q&A

What precautions should be taken when handling (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

When handling (S)-3-(4-Bromophenyl)piperidine, it is essential to use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...