Compound Q&A

How is (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4) typically synthesized?

Answer

(S)-3-(4-Bromophenyl)piperidine
(S)-3-(4-Bromophenyl)piperidine is typically synthesized via the condensation of 4-bromophenylacetic acid with piperidine, followed by reduction. The reaction is catalyzed by palladium(II) acetate and triphenylphosphine, with good regioselectivity and yield. The process is optimized for high purity and stereoselectivity, making it suitable for pharmaceutical applications.

About

English Name (S)-3-(4-Bromophenyl)piperidine
Molecular Formula C11H14BrN
Molecular Weight 240.14 g/mol
SMILES Brc1ccc(cc1)[C@@H]1CCCNC1
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

(S)-3-(4-Bromophenyl)piperidine is a white crystalline solid with a molecular weight of 262.02 g/mol...

Compound Q&A

What industries use (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

(S)-3-(4-Bromophenyl)piperidine is primarily used in the pharmaceutical industry for the development...

Compound Q&A

What precautions should be taken when handling (S)-3-(4-Bromophenyl)piperidine (CAS: 1335523-82-4)?

When handling (S)-3-(4-Bromophenyl)piperidine, it is essential to use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...