Compound Q&A

What precautions should be taken when handling Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Answer

Methyl 2,4,5-triamino-3-fluorobenzoate
When handling Methyl 2,4,5-triamino-3-fluorobenzoate, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be handled with caution using appropriate spill kits, and the Material Safety Data Sheet (MSDS) should always be referenced for detailed safety information.

About

English Name Methyl 2,4,5-triamino-3-fluorobenzoate
Molecular Formula C8H10FN3O2
Molecular Weight 199.18 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1N)F)N)N
InChIKey RADQVYGLIBGGAP-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Methyl 2,4,5-triamino-3-fluorobenzoate is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4) typically synthesized?

Methyl 2,4,5-triamino-3-fluorobenzoate is typically synthesized through a multi-step process involvi...

Compound Q&A

What industries use Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Methyl 2,4,5-triamino-3-fluorobenzoate finds applications in the pharmaceutical industry, particular...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...