Compound Q&A

What are the physical and chemical properties of Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Answer

Methyl 2,4,5-triamino-3-fluorobenzoate
Methyl 2,4,5-triamino-3-fluorobenzoate is a white crystalline solid with a molecular weight of approximately 229.21 g/mol. It has a solubility of about 6.5 g/L in water and is practically insoluble in most organic solvents. Chemically, it is highly reactive due to the amine groups and the fluorine substituent, making it prone to nucleophilic substitution and other reactions.

About

English Name Methyl 2,4,5-triamino-3-fluorobenzoate
Molecular Formula C8H10FN3O2
Molecular Weight 199.18 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1N)F)N)N
InChIKey RADQVYGLIBGGAP-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4) typically synthesized?

Methyl 2,4,5-triamino-3-fluorobenzoate is typically synthesized through a multi-step process involvi...

Compound Q&A

What industries use Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Methyl 2,4,5-triamino-3-fluorobenzoate finds applications in the pharmaceutical industry, particular...

Compound Q&A

What precautions should be taken when handling Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

When handling Methyl 2,4,5-triamino-3-fluorobenzoate, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...