Compound Q&A

What industries use Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Answer

Methyl 2,4,5-triamino-3-fluorobenzoate
Methyl 2,4,5-triamino-3-fluorobenzoate finds applications in the pharmaceutical industry, particularly in the development of novel drugs and intermediates. It is also used in the synthesis of certain polymers and sensors due to its unique chemical properties.

About

English Name Methyl 2,4,5-triamino-3-fluorobenzoate
Molecular Formula C8H10FN3O2
Molecular Weight 199.18 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1N)F)N)N
InChIKey RADQVYGLIBGGAP-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Methyl 2,4,5-triamino-3-fluorobenzoate is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4) typically synthesized?

Methyl 2,4,5-triamino-3-fluorobenzoate is typically synthesized through a multi-step process involvi...

Compound Q&A

What precautions should be taken when handling Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

When handling Methyl 2,4,5-triamino-3-fluorobenzoate, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...