Compound Q&A

How is Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4) typically synthesized?

Answer

Methyl 2,4,5-triamino-3-fluorobenzoate
Methyl 2,4,5-triamino-3-fluorobenzoate is typically synthesized through a multi-step process involving the protection of the carboxylic acid group, followed by the introduction of the amine groups and fluorination. Commonly, this involves the use of protecting agents like tert-butyldimethylsilyl chloride and subsequent deprotection using fluoride sources under controlled conditions.

About

English Name Methyl 2,4,5-triamino-3-fluorobenzoate
Molecular Formula C8H10FN3O2
Molecular Weight 199.18 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1N)F)N)N
InChIKey RADQVYGLIBGGAP-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Methyl 2,4,5-triamino-3-fluorobenzoate is a white crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

Methyl 2,4,5-triamino-3-fluorobenzoate finds applications in the pharmaceutical industry, particular...

Compound Q&A

What precautions should be taken when handling Methyl 2,4,5-triamino-3-fluorobenzoate (CAS: 918321-27-4)?

When handling Methyl 2,4,5-triamino-3-fluorobenzoate, it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...