Compound Q&A

What precautions should be taken when handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Answer

Ethyl 2-fluoro-5-iodobenzoate
When handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6), it is essential to wear appropriate personal protective equipment, including gloves, goggles, and a lab coat. Operations should be conducted in a well-ventilated area or fume hood due to its volatility. Spills should be handled carefully, and the material safety data sheet (MSDS) should be consulted for detailed spill procedures and emergency response information.

About

English Name Ethyl 2-fluoro-5-iodobenzoate
Molecular Formula C9H8FIO2
Molecular Weight 294.06 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)I)F
InChIKey GHRYAGFJSZGCAQ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is a crystalline compound with a molecular weight o...

Compound Q&A

How is Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) typically synthesized?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) can be synthesized through a multi-step process inv...

Compound Q&A

What industries use Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is primarily used in pharmaceutical and chemical in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...