Compound Q&A

What are the physical and chemical properties of Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Answer

Ethyl 2-fluoro-5-iodobenzoate
Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is a crystalline compound with a molecular weight of approximately 333.03 g/mol. It has a high solubility in organic solvents like methanol and acetone but is only slightly soluble in water. Chemically, it is relatively stable but can react with bases. It is typically stored at room temperature and away from humid environments.

About

English Name Ethyl 2-fluoro-5-iodobenzoate
Molecular Formula C9H8FIO2
Molecular Weight 294.06 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)I)F
InChIKey GHRYAGFJSZGCAQ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) typically synthesized?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) can be synthesized through a multi-step process inv...

Compound Q&A

What industries use Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is primarily used in pharmaceutical and chemical in...

Compound Q&A

What precautions should be taken when handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

When handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...