Compound Q&A

How is Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) typically synthesized?

Answer

Ethyl 2-fluoro-5-iodobenzoate
Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) can be synthesized through a multi-step process involving the initial formation of 2-fluoro-5-iodobenzoic acid followed by its esterification with ethanol. The synthesis typically uses thionyl chloride as an acylating agent and requires careful control of reaction conditions to achieve high yields and selectivity.

About

English Name Ethyl 2-fluoro-5-iodobenzoate
Molecular Formula C9H8FIO2
Molecular Weight 294.06 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)I)F
InChIKey GHRYAGFJSZGCAQ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is a crystalline compound with a molecular weight o...

Compound Q&A

What industries use Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is primarily used in pharmaceutical and chemical in...

Compound Q&A

What precautions should be taken when handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

When handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...