Compound Q&A

What industries use Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Answer

Ethyl 2-fluoro-5-iodobenzoate
Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is primarily used in pharmaceutical and chemical industries for the synthesis of intermediates and active pharmaceutical ingredients. It also finds applications in the production of certain polymers and in analytical chemistry for reagent development.

About

English Name Ethyl 2-fluoro-5-iodobenzoate
Molecular Formula C9H8FIO2
Molecular Weight 294.06 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)I)F
InChIKey GHRYAGFJSZGCAQ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) is a crystalline compound with a molecular weight o...

Compound Q&A

How is Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) typically synthesized?

Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6) can be synthesized through a multi-step process inv...

Compound Q&A

What precautions should be taken when handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6)?

When handling Ethyl 2-fluoro-5-iodobenzoate (CAS: 773136-66-6), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...