Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

Answer

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
When handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or fume hood to avoid inhalation. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures. This compound is highly reactive and can cause irritation or burns if it comes into contact with skin or eyes.

About

English Name [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
Molecular Formula C8H6ClF3O2S
Molecular Weight 258.65 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CS(=O)(=O)Cl
InChIKey WIGCBGFBBRJTLS-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is a white crystalline solid with a molecular we...

Compound Q&A

How is [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3) typically synthesized?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is synthesized through the reaction of 3-(triflu...

Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is used in a variety of industries, particularly...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...