Compound Q&A

How is [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3) typically synthesized?

Answer

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is synthesized through the reaction of 3-(trifluoromethyl)phenylmethanol with methanesulfonyl chloride in the presence of a base like triethylamine. The reaction is typically carried out in an anhydrous organic solvent like dichloromethane. The yield is generally high, and the product can be isolated by filtration and recrystallization. The reaction is highly selective and proceeds with good regiochemical control.

About

English Name [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
Molecular Formula C8H6ClF3O2S
Molecular Weight 258.65 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CS(=O)(=O)Cl
InChIKey WIGCBGFBBRJTLS-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is a white crystalline solid with a molecular we...

Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is used in a variety of industries, particularly...

Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

When handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride, it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...