Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

Answer

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is a white crystalline solid with a molecular weight of approximately 354.14 g/mol. It has a low solubility in water but is soluble in common organic solvents like dichloromethane and acetonitrile. This compound is highly reactive, particularly towards nucleophiles, and can undergo substitution reactions. It is stable under normal temperature and pressure conditions but requires handling in a fume hood to avoid inhalation and skin contact.

About

English Name [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
Molecular Formula C8H6ClF3O2S
Molecular Weight 258.65 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CS(=O)(=O)Cl
InChIKey WIGCBGFBBRJTLS-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3) typically synthesized?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is synthesized through the reaction of 3-(triflu...

Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is used in a variety of industries, particularly...

Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

When handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride, it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...