Compound Q&A

What industries use [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

Answer

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is used in a variety of industries, particularly in pharmaceuticals and as a reagent in organic synthesis. It serves as a building block for synthesizing complex molecules and is used in the development of new drugs. Additionally, it finds applications in the synthesis of polymerization initiators, sensors, and as a reagent in semiconductor fabrication processes.

About

English Name [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride
Molecular Formula C8H6ClF3O2S
Molecular Weight 258.65 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)CS(=O)(=O)Cl
InChIKey WIGCBGFBBRJTLS-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is a white crystalline solid with a molecular we...

Compound Q&A

How is [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3) typically synthesized?

[3-(Trifluoromethyl)phenyl]methanesulfonyl chloride is synthesized through the reaction of 3-(triflu...

Compound Q&A

What precautions should be taken when handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride (CAS: 127162-96-3)?

When handling [3-(Trifluoromethyl)phenyl]methanesulfonyl chloride, it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...