Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

Answer

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
When handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid, it is essential to wear appropriate personal protective equipment such as gloves, goggles, and a lab coat. Store it in a cool, dry place away from direct sunlight. Use a fume hood during synthesis and handling to avoid inhaling dust or fumes. In case of a spill, immediately clean up using appropriate absorbent materials and consult the Safety Data Sheet (SDS) for detailed instructions.

About

English Name (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(CC(=O)O)N
InChIKey QGHQDRDWQIHGKZ-QMMMGPOBSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is a white crystalline solid. It has a molecular w...

Compound Q&A

How is (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9) typically synthesized?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid can be synthesized via a multi-step process involv...

Compound Q&A

What industries use (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is primarily used in the pharmaceutical industry f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...