Compound Q&A

How is (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9) typically synthesized?

Answer

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid can be synthesized via a multi-step process involving the reaction of 2,4-dichlorobenzaldehyde with ammonia to form the corresponding imine, followed by reduction to the amino alcohol and subsequent esterification. This process often requires the use of palladium catalysts and selective reagents to ensure high yield and purity.

About

English Name (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(CC(=O)O)N
InChIKey QGHQDRDWQIHGKZ-QMMMGPOBSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is a white crystalline solid. It has a molecular w...

Compound Q&A

What industries use (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

When handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...