Compound Q&A

What industries use (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

Answer

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is primarily used in the pharmaceutical industry for the synthesis of certain drug candidates. It may also have some applications in the polymer industry for developing functional polymers, and in sensor technology for detecting specific chemical compounds. Its use in semiconductors is less common but not entirely ruled out.

About

English Name (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(CC(=O)O)N
InChIKey QGHQDRDWQIHGKZ-QMMMGPOBSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is a white crystalline solid. It has a molecular w...

Compound Q&A

How is (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9) typically synthesized?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid can be synthesized via a multi-step process involv...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

When handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...