Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

Answer

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is a white crystalline solid. It has a molecular weight of approximately 275.03 g/mol and a solubility of about 10 mg/L in water. It is relatively stable in air and light but can react with bases to form amines. It has limited solubility in common organic solvents like ethanol and acetone. This compound is not highly reactive but can undergo nucleophilic substitutions under certain conditions.

About

English Name (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(CC(=O)O)N
InChIKey QGHQDRDWQIHGKZ-QMMMGPOBSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9) typically synthesized?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid can be synthesized via a multi-step process involv...

Compound Q&A

What industries use (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

(3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid (CAS: 757937-66-9)?

When handling (3S)-3-Amino-3-(2,4-dichlorophenyl)propanoic acid, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...