Compound Q&A

What are the physical and chemical properties of (1R)-1-[3-(Trifluoromethyl)phenyl]ethanol (CAS: 127852-24-8)?

Answer

(1R)-1-[3-(Trifluoromethyl)phenyl]ethanol
(1R)-1-[3-(Trifluoromethyl)phenyl]ethanol is a colorless liquid with a molecular weight of approximately 250.14 g/mol. It has a boiling point of 98.5°C and a density of 1.23 g/cm³. This compound is poorly soluble in water but is miscible with most organic solvents. It exhibits moderate reactivity, particularly towards nucleophiles, and can undergo substitution reactions. Its physical properties make it suitable for various applications in organic synthesis and pharmaceuticals.

About

English Name (1R)-1-[3-(Trifluoromethyl)phenyl]ethanol
Molecular Formula C9H9F3O
Molecular Weight 190.16 g/mol
SMILES CC(C1=CC(=CC=C1)C(F)(F)F)O
InChIKey YNVXCOKNHXMBQC-ZCFIWIBFSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is (1R)-1-[3-(Trifluoromethyl)phenyl]ethanol (CAS: 127852-24-8) typically synthesized?

(1R)-1-[3-(Trifluoromethyl)phenyl]ethanol is typically synthesized via a Friedel-Crafts alkylation r...

Compound Q&A

What industries use (1R)-1-[3-(Trifluoromethyl)phenyl]ethanol (CAS: 127852-24-8)?

(1R)-1-[3-(Trifluoromethyl)phenyl]ethanol is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling (1R)-1-[3-(Trifluoromethyl)phenyl]ethanol (CAS: 127852-24-8)?

When handling (1R)-1-[3-(Trifluoromethyl)phenyl]ethanol, it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...