Compound Q&A

What precautions should be taken when handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

Answer

5-Methyl-2-(trifluoromethyl)-3-furoic acid
When handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid, it is essential to wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Store the compound in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and storage instructions.

About

CAS No 17515-74-1
English Name 5-Methyl-2-(trifluoromethyl)-3-furoic acid
Molecular Formula C7H5F3O3
Molecular Weight 194.11 g/mol
SMILES CC1=CC(=C(O1)C(F)(F)F)C(=O)O
InChIKey NURNFMNHTHXTDS-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1) typically synthesized?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is typically synthesized via the condensation of methyl t...

Compound Q&A

What industries use 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...