Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

Answer

5-Methyl-2-(trifluoromethyl)-3-furoic acid
5-Methyl-2-(trifluoromethyl)-3-furoic acid is a crystalline solid with a molecular weight of approximately 217.06 g/mol. It has a low water solubility, with a maximum solubility of about 0.02 g/100 mL in water at room temperature. The compound is known for its high reactivity, particularly in esterification reactions and its ability to form stable complexes with various metal ions.

About

CAS No 17515-74-1
English Name 5-Methyl-2-(trifluoromethyl)-3-furoic acid
Molecular Formula C7H5F3O3
Molecular Weight 194.11 g/mol
SMILES CC1=CC(=C(O1)C(F)(F)F)C(=O)O
InChIKey NURNFMNHTHXTDS-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1) typically synthesized?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is typically synthesized via the condensation of methyl t...

Compound Q&A

What industries use 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

When handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...