Compound Q&A

What industries use 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

Answer

5-Methyl-2-(trifluoromethyl)-3-furoic acid
5-Methyl-2-(trifluoromethyl)-3-furoic acid is primarily used in the pharmaceutical industry for the synthesis of certain drug molecules. It is also utilized in the polymer industry for the modification of polymers, and in the semiconductor industry for the fabrication of sensitive electronic components and sensors.

About

CAS No 17515-74-1
English Name 5-Methyl-2-(trifluoromethyl)-3-furoic acid
Molecular Formula C7H5F3O3
Molecular Weight 194.11 g/mol
SMILES CC1=CC(=C(O1)C(F)(F)F)C(=O)O
InChIKey NURNFMNHTHXTDS-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1) typically synthesized?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is typically synthesized via the condensation of methyl t...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

When handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...