Compound Q&A

How is 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1) typically synthesized?

Answer

5-Methyl-2-(trifluoromethyl)-3-furoic acid
5-Methyl-2-(trifluoromethyl)-3-furoic acid is typically synthesized via the condensation of methyl trifluoromethyl ketone with formic acid, followed by a Claisen rearrangement. This process often involves the use of a strong base like potassium tert-butoxide. The yield is generally high, and the reaction is known for its good selectivity.

About

CAS No 17515-74-1
English Name 5-Methyl-2-(trifluoromethyl)-3-furoic acid
Molecular Formula C7H5F3O3
Molecular Weight 194.11 g/mol
SMILES CC1=CC(=C(O1)C(F)(F)F)C(=O)O
InChIKey NURNFMNHTHXTDS-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

5-Methyl-2-(trifluoromethyl)-3-furoic acid is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid (CAS: 17515-74-1)?

When handling 5-Methyl-2-(trifluoromethyl)-3-furoic acid, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...