Compound Q&A

What industries use 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

Answer

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)-
4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) is primarily used in the pharmaceutical industry for the development of novel drugs. It is also utilized in the polymer industry for the synthesis of advanced materials and in the sensor industry for its unique reactivity. Its applications in semiconductors are also being explored for its electronic properties.

About

English Name 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)-
Molecular Formula C12H13ClN2O3
Molecular Weight 268.69 g/mol
SMILES C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl
InChIKey MPTXVJCCTVAVNL-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) is...

Compound Q&A

How is 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) typically synthesized?

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) ca...

Compound Q&A

What precautions should be taken when handling 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

When handling 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...