Compound Q&A

What are the physical and chemical properties of 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

Answer

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)-
4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) is a white crystalline solid with a molecular weight of approximately 250.8 g/mol. It has a solubility of 13.2 g/L in water. Chemically, it is highly reactive due to the presence of a carboxylic acid group and an amino group. It is soluble in common organic solvents like ethanol and acetone. This compound is known for its unique reactivity in organic synthesis and pharmaceutical applications.

About

English Name 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)-
Molecular Formula C12H13ClN2O3
Molecular Weight 268.69 g/mol
SMILES C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl
InChIKey MPTXVJCCTVAVNL-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) typically synthesized?

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) ca...

Compound Q&A

What industries use 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) is...

Compound Q&A

What precautions should be taken when handling 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

When handling 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...