Compound Q&A

How is 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) typically synthesized?

Answer

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)-
4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) can be synthesized through a multi-step process involving the reaction of 4-quinolinecarboxylic acid with aminopropanoyl chloride, followed by hydrochloric acid treatment. This synthesis typically requires amines, chloroacetic acid, and aminopropanol. The process yields a pure product with high selectivity and good yield under controlled conditions.

About

English Name 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)-
Molecular Formula C12H13ClN2O3
Molecular Weight 268.69 g/mol
SMILES C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl
InChIKey MPTXVJCCTVAVNL-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) is...

Compound Q&A

What industries use 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3) is...

Compound Q&A

What precautions should be taken when handling 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 132210-24-3)?

When handling 4-Quinolinepropanoic acid, a-amino-1,2-dihydro-2-oxo-,monohydrochloride, (±)- (CAS: 1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...