Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-amine (CAS: 525-03-1)?

Answer

9H-Fluoren-9-amine
When handling 9H-Fluoren-9-amine (CAS: 525-03-1), it is crucial to follow proper laboratory safety protocols. Wear appropriate personal protective equipment (PPE), such as gloves and safety goggles. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Ensure proper spill containment and disposal. Always refer to the Safety Data Sheet (SDS) for detailed safety information. Avoid contact with skin and eyes and do not ingest the compound. Proper training and awareness of potential hazards are essential for safe handling.

About

CAS No 525-03-1
English Name 9H-Fluoren-9-amine
Molecular Formula C13H11N
Molecular Weight 181.24 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)N
InChIKey OUGMRQJTULXVDC-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-amine (CAS: 525-03-1)?

9H-Fluoren-9-amine (CAS: 525-03-1) is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

How is 9H-Fluoren-9-amine (CAS: 525-03-1) typically synthesized?

9H-Fluoren-9-amine (CAS: 525-03-1) is typically synthesized through the amination of fluorene. The p...

Compound Q&A

What industries use 9H-Fluoren-9-amine (CAS: 525-03-1)?

9H-Fluoren-9-amine (CAS: 525-03-1) is used in various industries due to its unique chemical properti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...