Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-amine (CAS: 525-03-1)?

Answer

9H-Fluoren-9-amine
9H-Fluoren-9-amine (CAS: 525-03-1) is a crystalline solid with a molecular weight of approximately 158.22 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and dimethyl sulfoxide. This compound is known for its chemical reactivity, particularly towards electrophilic aromatic substitution reactions. It is moderately stable under normal conditions but should be handled with care due to its potential reactivity.

About

CAS No 525-03-1
English Name 9H-Fluoren-9-amine
Molecular Formula C13H11N
Molecular Weight 181.24 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)N
InChIKey OUGMRQJTULXVDC-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 9H-Fluoren-9-amine (CAS: 525-03-1) typically synthesized?

9H-Fluoren-9-amine (CAS: 525-03-1) is typically synthesized through the amination of fluorene. The p...

Compound Q&A

What industries use 9H-Fluoren-9-amine (CAS: 525-03-1)?

9H-Fluoren-9-amine (CAS: 525-03-1) is used in various industries due to its unique chemical properti...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-amine (CAS: 525-03-1)?

When handling 9H-Fluoren-9-amine (CAS: 525-03-1), it is crucial to follow proper laboratory safety p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...