Compound Q&A

What industries use 9H-Fluoren-9-amine (CAS: 525-03-1)?

Answer

9H-Fluoren-9-amine
9H-Fluoren-9-amine (CAS: 525-03-1) is used in various industries due to its unique chemical properties. It is primarily used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. In the polymer industry, it is utilized as a starting material for producing functionalized polymers. Additionally, it plays a role in the development of chemical sensors and semiconductors, particularly in the electronics sector.

About

CAS No 525-03-1
English Name 9H-Fluoren-9-amine
Molecular Formula C13H11N
Molecular Weight 181.24 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)N
InChIKey OUGMRQJTULXVDC-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-amine (CAS: 525-03-1)?

9H-Fluoren-9-amine (CAS: 525-03-1) is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

How is 9H-Fluoren-9-amine (CAS: 525-03-1) typically synthesized?

9H-Fluoren-9-amine (CAS: 525-03-1) is typically synthesized through the amination of fluorene. The p...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-amine (CAS: 525-03-1)?

When handling 9H-Fluoren-9-amine (CAS: 525-03-1), it is crucial to follow proper laboratory safety p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...