Compound Q&A

How is 9H-Fluoren-9-amine (CAS: 525-03-1) typically synthesized?

Answer

9H-Fluoren-9-amine
9H-Fluoren-9-amine (CAS: 525-03-1) is typically synthesized through the amination of fluorene. The process involves treating fluorene with an amine in the presence of a suitable catalyst, such as a Lewis acid or amines. The reaction is carried out under mild conditions to achieve high yield and selectivity. Common amine sources include triethylamine or morpholine, and the use of a dehydrating agent may be necessary to remove water and enhance the reaction.

About

CAS No 525-03-1
English Name 9H-Fluoren-9-amine
Molecular Formula C13H11N
Molecular Weight 181.24 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)N
InChIKey OUGMRQJTULXVDC-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-amine (CAS: 525-03-1)?

9H-Fluoren-9-amine (CAS: 525-03-1) is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

What industries use 9H-Fluoren-9-amine (CAS: 525-03-1)?

9H-Fluoren-9-amine (CAS: 525-03-1) is used in various industries due to its unique chemical properti...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-amine (CAS: 525-03-1)?

When handling 9H-Fluoren-9-amine (CAS: 525-03-1), it is crucial to follow proper laboratory safety p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...