Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

Answer

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
When handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be immediately contained and cleaned up using appropriate absorbents, and any waste should be disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
Molecular Formula C11H19F3N2O2
Molecular Weight 268.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)CC1
InChIKey YCMAOUJIMAOLCO-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is a white or off-white crystal...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2) typically synthesized?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is typically synthesized throug...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is primarily used in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...