Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

Answer

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is primarily used in the pharmaceutical and chemical industries. It serves as an intermediate in the synthesis of various drugs and is also utilized in polymer science for functionalizing materials. The compound's unique properties make it valuable for producing sensors and semiconductors, contributing to the development of advanced materials and technologies.

About

English Name 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
Molecular Formula C11H19F3N2O2
Molecular Weight 268.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)CC1
InChIKey YCMAOUJIMAOLCO-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is a white or off-white crystal...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2) typically synthesized?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

When handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...