Compound Q&A

How is 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2) typically synthesized?

Answer

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is typically synthesized through a multi-step process involving protection of a primary amine, followed by introduction of the trifluoroethyl group. The synthesis is catalyzed by common reagents such as diisopropylcarbamoyl chloride and can achieve high yields (up to 90%). The process is generally carried out under mild conditions and requires careful handling to prevent side reactions.

About

English Name 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
Molecular Formula C11H19F3N2O2
Molecular Weight 268.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)CC1
InChIKey YCMAOUJIMAOLCO-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is a white or off-white crystal...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

When handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...